C12H16FN4O4S+ — CID 157237411
(1,3-dimethylimidazol-1-ium-2-yl)-(2-fluorophenyl)diazene;methyl hydrogen sulfate (PubChem CID 157237411) has the molecular formula C12H16FN4O4S+ and a molecular weight of 331.35 g/mol. Its IUPAC name is (1,3-dimethylimidazol-1-ium-2-yl)-(2-fluorophenyl)diazene;methyl hydrogen sulfate.
| Compound Name | (1,3-dimethylimidazol-1-ium-2-yl)-(2-fluorophenyl)diazene;methyl hydrogen sulfate |
|---|---|
| PubChem CID | 157237411 |
| Molecular Formula | C12H16FN4O4S+ |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | (1,3-dimethylimidazol-1-ium-2-yl)-(2-fluorophenyl)diazene;methyl hydrogen sulfate |
| SMILES | COS(=O)(=O)O.Cn1cc[n+](C)c1/N=N/c1ccccc1F |
| InChI | InChI=1S/C11H12FN4.CH4O4S/c1-15-7-8-16(2)11(15)14-13-10-6-4-3-5-9(10)12;1-5-6(2,3)4/h3-8H,1-2H3;1H3,(H,2,3,4)/q+1; |
| InChIKey | AUUMTZJDDLPMTK-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 97.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|