C18H29N7O5S — CID 158764209
N-[3-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]-4-[methyl-[2-(methylamino)ethyl]amino]phenyl]acetamide;methyl sulfate (PubChem CID 158764209) has the molecular formula C18H29N7O5S and a molecular weight of 455.54 g/mol. Its IUPAC name is N-[3-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]-4-[methyl-[2-(methylamino)ethyl]amino]phenyl]acetamide;methyl sulfate.
| Compound Name | N-[3-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]-4-[methyl-[2-(methylamino)ethyl]amino]phenyl]acetamide;methyl sulfate |
|---|---|
| PubChem CID | 158764209 |
| Molecular Formula | C18H29N7O5S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | N-[3-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]-4-[methyl-[2-(methylamino)ethyl]amino]phenyl]acetamide;methyl sulfate |
| SMILES | CNCCN(C)c1ccc(NC(C)=O)cc1/N=N/c1n(C)cc[n+]1C.COS(=O)(=O)[O-] |
| InChI | InChI=1S/C17H25N7O.CH4O4S/c1-13(25)19-14-6-7-16(22(3)9-8-18-2)15(12-14)20-21-17-23(4)10-11-24(17)5;1-5-6(2,3)4/h6-7,10-12,18H,8-9H2,1-5H3;1H3,(H,2,3,4) |
| InChIKey | IPAZRHJIJDZDED-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 144.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|