C16H24N5O2+ — CID 88905249
N-[3-[2-(1,3-dimethylimidazol-1-ium-2-yl)hydrazinyl]-4-(3-hydroxypropyl)phenyl]acetamide (PubChem CID 88905249) has the molecular formula C16H24N5O2+ and a molecular weight of 318.40 g/mol. Its IUPAC name is N-[3-[2-(1,3-dimethylimidazol-1-ium-2-yl)hydrazinyl]-4-(3-hydroxypropyl)phenyl]acetamide.
| Compound Name | N-[3-[2-(1,3-dimethylimidazol-1-ium-2-yl)hydrazinyl]-4-(3-hydroxypropyl)phenyl]acetamide |
|---|---|
| PubChem CID | 88905249 |
| Molecular Formula | C16H24N5O2+ |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | N-[3-[2-(1,3-dimethylimidazol-1-ium-2-yl)hydrazinyl]-4-(3-hydroxypropyl)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(CCCO)c(NNc2n(C)cc[n+]2C)c1 |
| InChI | InChI=1S/C16H23N5O2/c1-12(23)17-14-7-6-13(5-4-10-22)15(11-14)18-19-16-20(2)8-9-21(16)3/h6-9,11,18,22H,4-5,10H2,1-3H3,(H,17,23)/p+1 |
| InChIKey | CFSSFYWKIHHSQV-UHFFFAOYSA-O |
| XLogP | 1.17 |
| TPSA | 82.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|