C22H34N5O2+ — CID 138514010
N-[5-(dibutylcarbamoylamino)-2-methylphenyl]-1,3-dimethylimidazol-1-ium-2-carboxamide (PubChem CID 138514010) has the molecular formula C22H34N5O2+ and a molecular weight of 400.55 g/mol. Its IUPAC name is N-[5-(dibutylcarbamoylamino)-2-methylphenyl]-1,3-dimethylimidazol-1-ium-2-carboxamide.
| Compound Name | N-[5-(dibutylcarbamoylamino)-2-methylphenyl]-1,3-dimethylimidazol-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 138514010 |
| Molecular Formula | C22H34N5O2+ |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.27 |
| IUPAC Name | N-[5-(dibutylcarbamoylamino)-2-methylphenyl]-1,3-dimethylimidazol-1-ium-2-carboxamide |
| SMILES | CCCCN(CCCC)C(=O)Nc1ccc(C)c(NC(=O)c2n(C)cc[n+]2C)c1 |
| InChI | InChI=1S/C22H33N5O2/c1-6-8-12-27(13-9-7-2)22(29)23-18-11-10-17(3)19(16-18)24-20(28)21-25(4)14-15-26(21)5/h10-11,14-16H,6-9,12-13H2,1-5H3,(H-,23,24,28,29)/p+1 |
| InChIKey | BKGABNWZZGIZLB-UHFFFAOYSA-O |
| XLogP | 3.84 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|