C25H44N4O2 — CID 112758600
1-butyl-3-[3-[[butyl(1,1,2,2,3,3,4,4,4-nonadeuteriobutyl)carbamoyl]amino]-4-methylphenyl]-1-(1,1,2,2,3,3,4,4,4-nonadeuteriobutyl)urea (PubChem CID 112758600) has the molecular formula C25H44N4O2 and a molecular weight of 450.76 g/mol. Its IUPAC name is 1-butyl-3-[3-[[butyl(1,1,2,2,3,3,4,4,4-nonadeuteriobutyl)carbamoyl]amino]-4-methylphenyl]-1-(1,1,2,2,3,3,4,4,4-nonadeuteriobutyl)urea.
| Compound Name | 1-butyl-3-[3-[[butyl(1,1,2,2,3,3,4,4,4-nonadeuteriobutyl)carbamoyl]amino]-4-methylphenyl]-1-(1,1,2,2,3,3,4,4,4-nonadeuteriobutyl)urea |
|---|---|
| PubChem CID | 112758600 |
| Molecular Formula | C25H44N4O2 |
| Molecular Weight | 450.76 g/mol |
| Exact Mass | 450.46 |
| IUPAC Name | 1-butyl-3-[3-[[butyl(1,1,2,2,3,3,4,4,4-nonadeuteriobutyl)carbamoyl]amino]-4-methylphenyl]-1-(1,1,2,2,3,3,4,4,4-nonadeuteriobutyl)urea |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])N(CCCC)C(=O)Nc1ccc(C)c(NC(=O)N(CCCC)C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H])c1 |
| InChI | InChI=1S/C25H44N4O2/c1-6-10-16-28(17-11-7-2)24(30)26-22-15-14-21(5)23(20-22)27-25(31)29(18-12-8-3)19-13-9-4/h14-15,20H,6-13,16-19H2,1-5H3,(H,26,30)(H,27,31)/i1D3,3D3,6D2,8D2,10D2,12D2,16D2,18D2 |
| InChIKey | NMCJLWHQVDLBQO-VBLPWIQMSA-N |
| XLogP | 6.86 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.76 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |