C13H23N8+ — CID 172917963
N-(1,3-dimethylimidazol-1-ium-2-yl)imino-N'-[(1,3-dimethylimidazol-2-ylidene)amino]ethanimidamide;methane (PubChem CID 172917963) has the molecular formula C13H23N8+ and a molecular weight of 291.38 g/mol. Its IUPAC name is N-(1,3-dimethylimidazol-1-ium-2-yl)imino-N'-[(1,3-dimethylimidazol-2-ylidene)amino]ethanimidamide;methane.
| Compound Name | N-(1,3-dimethylimidazol-1-ium-2-yl)imino-N'-[(1,3-dimethylimidazol-2-ylidene)amino]ethanimidamide;methane |
|---|---|
| PubChem CID | 172917963 |
| Molecular Formula | C13H23N8+ |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | N-(1,3-dimethylimidazol-1-ium-2-yl)imino-N'-[(1,3-dimethylimidazol-2-ylidene)amino]ethanimidamide;methane |
| SMILES | C.CC(/N=N/c1n(C)cc[n+]1C)=N\N=c1n(C)ccn1C |
| InChI | InChI=1S/C12H19N8.CH4/c1-10(13-15-11-17(2)6-7-18(11)3)14-16-12-19(4)8-9-20(12)5;/h6-9H,1-5H3;1H4/q+1; |
| InChIKey | YRSPBBZJBADZKB-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 68.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|