C17H20N7+ — CID 157409641
N'-[(1,3-dimethylbenzimidazol-2-ylidene)amino]-N-(1-methylpyridin-1-ium-4-yl)iminoethanimidamide (PubChem CID 157409641) has the molecular formula C17H20N7+ and a molecular weight of 322.40 g/mol. Its IUPAC name is N'-[(1,3-dimethylbenzimidazol-2-ylidene)amino]-N-(1-methylpyridin-1-ium-4-yl)iminoethanimidamide.
| Compound Name | N'-[(1,3-dimethylbenzimidazol-2-ylidene)amino]-N-(1-methylpyridin-1-ium-4-yl)iminoethanimidamide |
|---|---|
| PubChem CID | 157409641 |
| Molecular Formula | C17H20N7+ |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | N'-[(1,3-dimethylbenzimidazol-2-ylidene)amino]-N-(1-methylpyridin-1-ium-4-yl)iminoethanimidamide |
| SMILES | CC(=NN=c1n(C)c2ccccc2n1C)/N=N/c1cc[n+](C)cc1 |
| InChI | InChI=1S/C17H20N7/c1-13(18-20-14-9-11-22(2)12-10-14)19-21-17-23(3)15-7-5-6-8-16(15)24(17)4/h5-12H,1-4H3/q+1 |
| InChIKey | UOMVTTKLZMZOOU-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 63.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|