C16H15ClN4S — CID 20521438
1-(4-chlorophenyl)-3-(1,3-dimethylbenzimidazol-2-ylidene)thiourea (PubChem CID 20521438) has the molecular formula C16H15ClN4S and a molecular weight of 330.84 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-(1,3-dimethylbenzimidazol-2-ylidene)thiourea.
| Compound Name | 1-(4-chlorophenyl)-3-(1,3-dimethylbenzimidazol-2-ylidene)thiourea |
|---|---|
| PubChem CID | 20521438 |
| Molecular Formula | C16H15ClN4S |
| Molecular Weight | 330.84 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 1-(4-chlorophenyl)-3-(1,3-dimethylbenzimidazol-2-ylidene)thiourea |
| SMILES | Cn1c(=NC(=S)Nc2ccc(Cl)cc2)n(C)c2ccccc21 |
| InChI | InChI=1S/C16H15ClN4S/c1-20-13-5-3-4-6-14(13)21(2)16(20)19-15(22)18-12-9-7-11(17)8-10-12/h3-10H,1-2H3,(H,18,22) |
| InChIKey | MOODPJSJCXAJLC-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 34.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.84 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|