C21H17ClN2OS — CID 165018533
N-(4-chlorophenyl)-2-(9-methylcarbazol-2-yl)sulfanylacetamide (PubChem CID 165018533) has the molecular formula C21H17ClN2OS and a molecular weight of 380.90 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-(9-methylcarbazol-2-yl)sulfanylacetamide.
| Compound Name | N-(4-chlorophenyl)-2-(9-methylcarbazol-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 165018533 |
| Molecular Formula | C21H17ClN2OS |
| Molecular Weight | 380.90 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | N-(4-chlorophenyl)-2-(9-methylcarbazol-2-yl)sulfanylacetamide |
| SMILES | Cn1c2ccccc2c2ccc(SCC(=O)Nc3ccc(Cl)cc3)cc21 |
| InChI | InChI=1S/C21H17ClN2OS/c1-24-19-5-3-2-4-17(19)18-11-10-16(12-20(18)24)26-13-21(25)23-15-8-6-14(22)7-9-15/h2-12H,13H2,1H3,(H,23,25) |
| InChIKey | KUMXHBVLAOEYSQ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.90 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |