C18H17ClN2O4S — CID 18897062
4-[3-[2-(4-chloroanilino)-2-oxoethyl]sulfanylanilino]-4-oxobutanoic acid (PubChem CID 18897062) has the molecular formula C18H17ClN2O4S and a molecular weight of 392.86 g/mol. Its IUPAC name is 4-[3-[2-(4-chloroanilino)-2-oxoethyl]sulfanylanilino]-4-oxobutanoic acid.
| Compound Name | 4-[3-[2-(4-chloroanilino)-2-oxoethyl]sulfanylanilino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18897062 |
| Molecular Formula | C18H17ClN2O4S |
| Molecular Weight | 392.86 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | 4-[3-[2-(4-chloroanilino)-2-oxoethyl]sulfanylanilino]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)Nc1cccc(SCC(=O)Nc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C18H17ClN2O4S/c19-12-4-6-13(7-5-12)20-17(23)11-26-15-3-1-2-14(10-15)21-16(22)8-9-18(24)25/h1-7,10H,8-9,11H2,(H,20,23)(H,21,22)(H,24,25) |
| InChIKey | DHGGLGAEXBBVHN-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.86 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |