C26H21ClN2O2S — CID 18902477
2-(4-chlorophenyl)-N-[3-[2-(naphthalen-1-ylamino)-2-oxoethyl]sulfanylphenyl]acetamide (PubChem CID 18902477) has the molecular formula C26H21ClN2O2S and a molecular weight of 460.99 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[3-[2-(naphthalen-1-ylamino)-2-oxoethyl]sulfanylphenyl]acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-[3-[2-(naphthalen-1-ylamino)-2-oxoethyl]sulfanylphenyl]acetamide |
|---|---|
| PubChem CID | 18902477 |
| Molecular Formula | C26H21ClN2O2S |
| Molecular Weight | 460.99 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[3-[2-(naphthalen-1-ylamino)-2-oxoethyl]sulfanylphenyl]acetamide |
| SMILES | O=C(Cc1ccc(Cl)cc1)Nc1cccc(SCC(=O)Nc2cccc3ccccc23)c1 |
| InChI | InChI=1S/C26H21ClN2O2S/c27-20-13-11-18(12-14-20)15-25(30)28-21-7-4-8-22(16-21)32-17-26(31)29-24-10-3-6-19-5-1-2-9-23(19)24/h1-14,16H,15,17H2,(H,28,30)(H,29,31) |
| InChIKey | UMLPCVZDJMSZTF-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.99 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |