C16H14ClNO3S — CID 15943018
4-[4-(4-chlorophenyl)sulfanylanilino]-4-oxobutanoic acid (PubChem CID 15943018) has the molecular formula C16H14ClNO3S and a molecular weight of 335.81 g/mol. Its IUPAC name is 4-[4-(4-chlorophenyl)sulfanylanilino]-4-oxobutanoic acid.
| Compound Name | 4-[4-(4-chlorophenyl)sulfanylanilino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 15943018 |
| Molecular Formula | C16H14ClNO3S |
| Molecular Weight | 335.81 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | 4-[4-(4-chlorophenyl)sulfanylanilino]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)Nc1ccc(Sc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C16H14ClNO3S/c17-11-1-5-13(6-2-11)22-14-7-3-12(4-8-14)18-15(19)9-10-16(20)21/h1-8H,9-10H2,(H,18,19)(H,20,21) |
| InChIKey | DFVOYHWUCJVJHC-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.81 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |