C10H16N4O3P+3 — CID 123665986
bis[(1,3-dimethylimidazol-1-ium-2-yl)oxy]-oxophosphanium (PubChem CID 123665986) has the molecular formula C10H16N4O3P+3 and a molecular weight of 271.24 g/mol. Its IUPAC name is bis[(1,3-dimethylimidazol-1-ium-2-yl)oxy]-oxophosphanium.
| Compound Name | bis[(1,3-dimethylimidazol-1-ium-2-yl)oxy]-oxophosphanium |
|---|---|
| PubChem CID | 123665986 |
| Molecular Formula | C10H16N4O3P+3 |
| Molecular Weight | 271.24 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | bis[(1,3-dimethylimidazol-1-ium-2-yl)oxy]-oxophosphanium |
| SMILES | Cn1cc[n+](C)c1O[P+](=O)Oc1n(C)cc[n+]1C |
| InChI | InChI=1S/C10H16N4O3P/c1-11-5-6-12(2)9(11)16-18(15)17-10-13(3)7-8-14(10)4/h5-8H,1-4H3/q+3 |
| InChIKey | DSZMAYRUSUCTSZ-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 53.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.24 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|