C11H13BCl2N2 — CID 139185817
dichloro-(1,3-dimethylimidazol-1-ium-2-yl)-phenylboranuide (PubChem CID 139185817) has the molecular formula C11H13BCl2N2 and a molecular weight of 254.96 g/mol. Its IUPAC name is dichloro-(1,3-dimethylimidazol-1-ium-2-yl)-phenylboranuide.
| Compound Name | dichloro-(1,3-dimethylimidazol-1-ium-2-yl)-phenylboranuide |
|---|---|
| PubChem CID | 139185817 |
| Molecular Formula | C11H13BCl2N2 |
| Molecular Weight | 254.96 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | dichloro-(1,3-dimethylimidazol-1-ium-2-yl)-phenylboranuide |
| SMILES | Cn1cc[n+](C)c1[B-](Cl)(Cl)c1ccccc1 |
| InChI | InChI=1S/C11H13BCl2N2/c1-15-8-9-16(2)11(15)12(13,14)10-6-4-3-5-7-10/h3-9H,1-2H3 |
| InChIKey | MOWWVBMWXIQUDG-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.96 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|