C42H36N8+2 — CID 135926486
5,15-bis(1,3-dimethylimidazol-1-ium-2-yl)-10,20-diphenyl-21,23-dihydroporphyrin (PubChem CID 135926486) has the molecular formula C42H36N8+2 and a molecular weight of 652.81 g/mol. Its IUPAC name is 5,15-bis(1,3-dimethylimidazol-1-ium-2-yl)-10,20-diphenyl-21,23-dihydroporphyrin.
| Compound Name | 5,15-bis(1,3-dimethylimidazol-1-ium-2-yl)-10,20-diphenyl-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 135926486 |
| Molecular Formula | C42H36N8+2 |
| Molecular Weight | 652.81 g/mol |
| Exact Mass | 652.31 |
| IUPAC Name | 5,15-bis(1,3-dimethylimidazol-1-ium-2-yl)-10,20-diphenyl-21,23-dihydroporphyrin |
| SMILES | Cn1cc[n+](C)c1-c1c2nc(c(-c3ccccc3)c3ccc([nH]3)c(-c3n(C)cc[n+]3C)c3nc(c(-c4ccccc4)c4ccc1[nH]4)C=C3)C=C2 |
| InChI | InChI=1S/C42H35N8/c1-47-23-24-48(2)41(47)39-33-19-15-29(43-33)37(27-11-7-5-8-12-27)31-17-21-35(45-31)40(42-49(3)25-26-50(42)4)36-22-18-32(46-36)38(28-13-9-6-10-14-28)30-16-20-34(39)44-30/h5-26H,1-4H3,(H,43,44,45,46)/q+1/p+1/b37-29-,37-31-,38-30-,38-32-,39-33+,39-34+,40-35+,40-36+ |
| InChIKey | CVYLSCPBTDMYOX-JRUCMOTOSA-O |
| XLogP | 7.65 |
| TPSA | 74.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.81 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|