C42H32F2MnN8+2 — CID 59049286
5,15-bis(1,3-dimethylimidazol-1-ium-2-yl)-10,20-bis(4-fluorophenyl)porphyrin-22,24-diide;manganese(2+) (PubChem CID 59049286) has the molecular formula C42H32F2MnN8+2 and a molecular weight of 741.71 g/mol. Its IUPAC name is 5,15-bis(1,3-dimethylimidazol-1-ium-2-yl)-10,20-bis(4-fluorophenyl)porphyrin-22,24-diide;manganese(2+).
| Compound Name | 5,15-bis(1,3-dimethylimidazol-1-ium-2-yl)-10,20-bis(4-fluorophenyl)porphyrin-22,24-diide;manganese(2+) |
|---|---|
| PubChem CID | 59049286 |
| Molecular Formula | C42H32F2MnN8+2 |
| Molecular Weight | 741.71 g/mol |
| Exact Mass | 741.21 |
| IUPAC Name | 5,15-bis(1,3-dimethylimidazol-1-ium-2-yl)-10,20-bis(4-fluorophenyl)porphyrin-22,24-diide;manganese(2+) |
| SMILES | Cn1cc[n+](C)c1-c1c2nc(c(-c3ccc(F)cc3)c3ccc([n-]3)c(-c3n(C)cc[n+]3C)c3nc(c(-c4ccc(F)cc4)c4ccc1[n-]4)C=C3)C=C2.[Mn+2] |
| InChI | InChI=1S/C42H32F2N8.Mn/c1-49-21-22-50(2)41(49)39-33-17-13-29(45-33)37(25-5-9-27(43)10-6-25)31-15-19-35(47-31)40(42-51(3)23-24-52(42)4)36-20-16-32(48-36)38(30-14-18-34(39)46-30)26-7-11-28(44)12-8-26;/h5-24H,1-4H3;/q;+2/b37-29-; |
| InChIKey | JYOONFBZONEQKI-SLSNRTAJSA-N |
| XLogP | 7.18 |
| TPSA | 71.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.71 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|