C22H21IN3+ — CID 155608240
1-(1,3-dimethylimidazol-1-ium-2-yl)iodanuidyl-4-(4-phenylphenyl)pyridin-1-ium (PubChem CID 155608240) has the molecular formula C22H21IN3+ and a molecular weight of 454.34 g/mol. Its IUPAC name is 1-(1,3-dimethylimidazol-1-ium-2-yl)iodanuidyl-4-(4-phenylphenyl)pyridin-1-ium.
| Compound Name | 1-(1,3-dimethylimidazol-1-ium-2-yl)iodanuidyl-4-(4-phenylphenyl)pyridin-1-ium |
|---|---|
| PubChem CID | 155608240 |
| Molecular Formula | C22H21IN3+ |
| Molecular Weight | 454.34 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | 1-(1,3-dimethylimidazol-1-ium-2-yl)iodanuidyl-4-(4-phenylphenyl)pyridin-1-ium |
| SMILES | Cn1cc[n+](C)c1[I-][n+]1ccc(-c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C22H21IN3/c1-24-16-17-25(2)22(24)23-26-14-12-21(13-15-26)20-10-8-19(9-11-20)18-6-4-3-5-7-18/h3-17H,1-2H3/q+1 |
| InChIKey | PCUSGISEIPIHCL-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 12.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.34 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|