C13H17N2OS+ — CID 817509
(1R)-2-(1,3-dimethylimidazol-1-ium-2-yl)sulfanyl-1-phenylethanol (PubChem CID 817509) has the molecular formula C13H17N2OS+ and a molecular weight of 249.36 g/mol. Its IUPAC name is (1R)-2-(1,3-dimethylimidazol-1-ium-2-yl)sulfanyl-1-phenylethanol.
| Compound Name | (1R)-2-(1,3-dimethylimidazol-1-ium-2-yl)sulfanyl-1-phenylethanol |
|---|---|
| PubChem CID | 817509 |
| Molecular Formula | C13H17N2OS+ |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | (1R)-2-(1,3-dimethylimidazol-1-ium-2-yl)sulfanyl-1-phenylethanol |
| SMILES | Cn1cc[n+](C)c1SC[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C13H17N2OS/c1-14-8-9-15(2)13(14)17-10-12(16)11-6-4-3-5-7-11/h3-9,12,16H,10H2,1-2H3/q+1/t12-/m0/s1 |
| InChIKey | FNCILXYOAYNHKV-LBPRGKRZSA-N |
| XLogP | 1.68 |
| TPSA | 29.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|