C24H28N4O2+2 — CID 102111964
(1R)-2-[3-[2-[3-[(2R)-2-hydroxy-2-phenylethyl]imidazol-3-ium-1-yl]ethyl]imidazol-1-ium-1-yl]-1-phenylethanol (PubChem CID 102111964) has the molecular formula C24H28N4O2+2 and a molecular weight of 404.51 g/mol. Its IUPAC name is (1R)-2-[3-[2-[3-[(2R)-2-hydroxy-2-phenylethyl]imidazol-3-ium-1-yl]ethyl]imidazol-1-ium-1-yl]-1-phenylethanol.
| Compound Name | (1R)-2-[3-[2-[3-[(2R)-2-hydroxy-2-phenylethyl]imidazol-3-ium-1-yl]ethyl]imidazol-1-ium-1-yl]-1-phenylethanol |
|---|---|
| PubChem CID | 102111964 |
| Molecular Formula | C24H28N4O2+2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | (1R)-2-[3-[2-[3-[(2R)-2-hydroxy-2-phenylethyl]imidazol-3-ium-1-yl]ethyl]imidazol-1-ium-1-yl]-1-phenylethanol |
| SMILES | O[C@@H](C[n+]1ccn(CCn2cc[n+](C[C@H](O)c3ccccc3)c2)c1)c1ccccc1 |
| InChI | InChI=1S/C24H28N4O2/c29-23(21-7-3-1-4-8-21)17-27-15-13-25(19-27)11-12-26-14-16-28(20-26)18-24(30)22-9-5-2-6-10-22/h1-10,13-16,19-20,23-24,29-30H,11-12,17-18H2/q+2/t23-,24-/m0/s1 |
| InChIKey | PDGNNAUMNVCCBG-ZEQRLZLVSA-N |
| XLogP | 2.03 |
| TPSA | 58.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|