C25H27N6+3 — CID 177499669
1,3-bis[2-(3-phenylimidazol-1-ium-1-yl)ethyl]imidazol-1-ium (PubChem CID 177499669) has the molecular formula C25H27N6+3 and a molecular weight of 411.53 g/mol. Its IUPAC name is 1,3-bis[2-(3-phenylimidazol-1-ium-1-yl)ethyl]imidazol-1-ium.
| Compound Name | 1,3-bis[2-(3-phenylimidazol-1-ium-1-yl)ethyl]imidazol-1-ium |
|---|---|
| PubChem CID | 177499669 |
| Molecular Formula | C25H27N6+3 |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | 1,3-bis[2-(3-phenylimidazol-1-ium-1-yl)ethyl]imidazol-1-ium |
| SMILES | c1ccc(-n2cc[n+](CCn3cc[n+](CC[n+]4ccn(-c5ccccc5)c4)c3)c2)cc1 |
| InChI | InChI=1S/C25H27N6/c1-3-7-24(8-4-1)30-19-17-28(22-30)15-13-26-11-12-27(21-26)14-16-29-18-20-31(23-29)25-9-5-2-6-10-25/h1-12,17-23H,13-16H2/q+3 |
| InChIKey | XKDUCIHLYKCXQY-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 26.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|