C29H27N8W2+ — CID 58671814
phenyl-[1-[2-[3-[2-[3-(phenyldiazenyl)pyridin-1-ium-1-yl]ethyl]imidazol-1-ium-1-yl]ethyl]pyridin-1-ium-4-yl]diazene;tungsten (PubChem CID 58671814) has the molecular formula C29H27N8W2+ and a molecular weight of 855.27 g/mol. Its IUPAC name is phenyl-[1-[2-[3-[2-[3-(phenyldiazenyl)pyridin-1-ium-1-yl]ethyl]imidazol-1-ium-1-yl]ethyl]pyridin-1-ium-4-yl]diazene;tungsten.
| Compound Name | phenyl-[1-[2-[3-[2-[3-(phenyldiazenyl)pyridin-1-ium-1-yl]ethyl]imidazol-1-ium-1-yl]ethyl]pyridin-1-ium-4-yl]diazene;tungsten |
|---|---|
| PubChem CID | 58671814 |
| Molecular Formula | C29H27N8W2+ |
| Molecular Weight | 855.27 g/mol |
| Exact Mass | 855.14 |
| IUPAC Name | phenyl-[1-[2-[3-[2-[3-(phenyldiazenyl)pyridin-1-ium-1-yl]ethyl]imidazol-1-ium-1-yl]ethyl]pyridin-1-ium-4-yl]diazene;tungsten |
| SMILES | [W].[W].[c-]1ccc(/N=N/c2cc[n+](CC[n+]3ccn(CC[n+]4cccc(/N=N/c5cc[c-]cc5)c4)c3)cc2)cc1 |
| InChI | InChI=1S/C29H27N8.2W/c1-3-8-26(9-4-1)30-32-28-13-16-34(17-14-28)18-20-36-22-23-37(25-36)21-19-35-15-7-12-29(24-35)33-31-27-10-5-2-6-11-27;;/h3-17,22-25H,18-21H2;;/q+1;;/b33-31+;; |
| InChIKey | DXZXAWLGMXOOMZ-UICDCHROSA-N |
| XLogP | 5.18 |
| TPSA | 66.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 855.27 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|