C15H25N5+2 — CID 139242308
3-[3-[[1-(3-aminopropyl)pyridin-1-ium-3-yl]methyl]imidazol-3-ium-1-yl]propan-1-amine (PubChem CID 139242308) has the molecular formula C15H25N5+2 and a molecular weight of 275.40 g/mol. Its IUPAC name is 3-[3-[[1-(3-aminopropyl)pyridin-1-ium-3-yl]methyl]imidazol-3-ium-1-yl]propan-1-amine.
| Compound Name | 3-[3-[[1-(3-aminopropyl)pyridin-1-ium-3-yl]methyl]imidazol-3-ium-1-yl]propan-1-amine |
|---|---|
| PubChem CID | 139242308 |
| Molecular Formula | C15H25N5+2 |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.21 |
| IUPAC Name | 3-[3-[[1-(3-aminopropyl)pyridin-1-ium-3-yl]methyl]imidazol-3-ium-1-yl]propan-1-amine |
| SMILES | NCCCn1cc[n+](Cc2ccc[n+](CCCN)c2)c1 |
| InChI | InChI=1S/C15H25N5/c16-5-2-8-18-7-1-4-15(12-18)13-20-11-10-19(14-20)9-3-6-17/h1,4,7,10-12,14H,2-3,5-6,8-9,13,16-17H2/q+2 |
| InChIKey | JPOPGMDAIGJXGM-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 64.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|