C21H33N2+ — CID 87807041
1-(10-methylundecyl)-3-phenylimidazol-1-ium (PubChem CID 87807041) has the molecular formula C21H33N2+ and a molecular weight of 313.51 g/mol. Its IUPAC name is 1-(10-methylundecyl)-3-phenylimidazol-1-ium.
| Compound Name | 1-(10-methylundecyl)-3-phenylimidazol-1-ium |
|---|---|
| PubChem CID | 87807041 |
| Molecular Formula | C21H33N2+ |
| Molecular Weight | 313.51 g/mol |
| Exact Mass | 313.26 |
| IUPAC Name | 1-(10-methylundecyl)-3-phenylimidazol-1-ium |
| SMILES | CC(C)CCCCCCCCC[n+]1ccn(-c2ccccc2)c1 |
| InChI | InChI=1S/C21H33N2/c1-20(2)13-9-6-4-3-5-7-12-16-22-17-18-23(19-22)21-14-10-8-11-15-21/h8,10-11,14-15,17-20H,3-7,9,12-13,16H2,1-2H3/q+1 |
| InChIKey | UQEUXKRHACQRGY-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.51 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|