C26H28N2P+ — CID 139168118
[3-(3-butylimidazol-3-ium-1-yl)phenyl]methyl-diphenylphosphane (PubChem CID 139168118) has the molecular formula C26H28N2P+ and a molecular weight of 399.50 g/mol. Its IUPAC name is [3-(3-butylimidazol-3-ium-1-yl)phenyl]methyl-diphenylphosphane.
| Compound Name | [3-(3-butylimidazol-3-ium-1-yl)phenyl]methyl-diphenylphosphane |
|---|---|
| PubChem CID | 139168118 |
| Molecular Formula | C26H28N2P+ |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | [3-(3-butylimidazol-3-ium-1-yl)phenyl]methyl-diphenylphosphane |
| SMILES | CCCC[n+]1ccn(-c2cccc(CP(c3ccccc3)c3ccccc3)c2)c1 |
| InChI | InChI=1S/C26H28N2P/c1-2-3-17-27-18-19-28(22-27)24-12-10-11-23(20-24)21-29(25-13-6-4-7-14-25)26-15-8-5-9-16-26/h4-16,18-20,22H,2-3,17,21H2,1H3/q+1 |
| InChIKey | NVQSEKXRRDHUKE-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|