C25H31N4+ — CID 153276082
2-[1-[(2S)-2,3-dimethyl-2H-imidazol-1-yl]-1-(2-methyl-3-phenylphenyl)ethyl]-1,3-dimethylimidazol-1-ium (PubChem CID 153276082) has the molecular formula C25H31N4+ and a molecular weight of 387.55 g/mol. Its IUPAC name is 2-[1-[(2S)-2,3-dimethyl-2H-imidazol-1-yl]-1-(2-methyl-3-phenylphenyl)ethyl]-1,3-dimethylimidazol-1-ium.
| Compound Name | 2-[1-[(2S)-2,3-dimethyl-2H-imidazol-1-yl]-1-(2-methyl-3-phenylphenyl)ethyl]-1,3-dimethylimidazol-1-ium |
|---|---|
| PubChem CID | 153276082 |
| Molecular Formula | C25H31N4+ |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.25 |
| IUPAC Name | 2-[1-[(2S)-2,3-dimethyl-2H-imidazol-1-yl]-1-(2-methyl-3-phenylphenyl)ethyl]-1,3-dimethylimidazol-1-ium |
| SMILES | Cc1c(-c2ccccc2)cccc1C(C)(c1n(C)cc[n+]1C)N1C=CN(C)[C@@H]1C |
| InChI | InChI=1S/C25H31N4/c1-19-22(21-11-8-7-9-12-21)13-10-14-23(19)25(3,24-27(5)15-16-28(24)6)29-18-17-26(4)20(29)2/h7-18,20H,1-6H3/q+1/t20-,25?/m0/s1 |
| InChIKey | KCWVLMKUDMCKOF-JINQPTGOSA-N |
| XLogP | 4.15 |
| TPSA | 15.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|