C26H27N4+ — CID 123181093
2-[3-[(2S)-2,3-dimethyl-2H-imidazol-1-yl]-2-methylphenyl]-1-methyl-3-phenylbenzimidazol-1-ium (PubChem CID 123181093) has the molecular formula C26H27N4+ and a molecular weight of 395.53 g/mol. Its IUPAC name is 2-[3-[(2S)-2,3-dimethyl-2H-imidazol-1-yl]-2-methylphenyl]-1-methyl-3-phenylbenzimidazol-1-ium.
| Compound Name | 2-[3-[(2S)-2,3-dimethyl-2H-imidazol-1-yl]-2-methylphenyl]-1-methyl-3-phenylbenzimidazol-1-ium |
|---|---|
| PubChem CID | 123181093 |
| Molecular Formula | C26H27N4+ |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | 2-[3-[(2S)-2,3-dimethyl-2H-imidazol-1-yl]-2-methylphenyl]-1-methyl-3-phenylbenzimidazol-1-ium |
| SMILES | Cc1c(-c2n(-c3ccccc3)c3ccccc3[n+]2C)cccc1N1C=CN(C)[C@@H]1C |
| InChI | InChI=1S/C26H27N4/c1-19-22(13-10-16-23(19)29-18-17-27(3)20(29)2)26-28(4)24-14-8-9-15-25(24)30(26)21-11-6-5-7-12-21/h5-18,20H,1-4H3/q+1/t20-/m0/s1 |
| InChIKey | BUZWXOAHJJGKGS-FQEVSTJZSA-N |
| XLogP | 5.00 |
| TPSA | 15.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|