C68H50N6+2 — CID 90380674
6,8-bis(1-methyl-3-phenylbenzimidazol-1-ium-2-yl)-1-N,1-N,3-N,3-N-tetraphenylpyrene-1,3-diamine (PubChem CID 90380674) has the molecular formula C68H50N6+2 and a molecular weight of 951.19 g/mol. Its IUPAC name is 6,8-bis(1-methyl-3-phenylbenzimidazol-1-ium-2-yl)-1-N,1-N,3-N,3-N-tetraphenylpyrene-1,3-diamine.
| Compound Name | 6,8-bis(1-methyl-3-phenylbenzimidazol-1-ium-2-yl)-1-N,1-N,3-N,3-N-tetraphenylpyrene-1,3-diamine |
|---|---|
| PubChem CID | 90380674 |
| Molecular Formula | C68H50N6+2 |
| Molecular Weight | 951.19 g/mol |
| Exact Mass | 950.41 |
| IUPAC Name | 6,8-bis(1-methyl-3-phenylbenzimidazol-1-ium-2-yl)-1-N,1-N,3-N,3-N-tetraphenylpyrene-1,3-diamine |
| SMILES | C[n+]1c(-c2cc(-c3n(-c4ccccc4)c4ccccc4[n+]3C)c3ccc4c(N(c5ccccc5)c5ccccc5)cc(N(c5ccccc5)c5ccccc5)c5ccc2c3c54)n(-c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C68H50N6/c1-69-59-37-21-23-39-61(59)73(51-33-17-7-18-34-51)67(69)57-45-58(68-70(2)60-38-22-24-40-62(60)74(68)52-35-19-8-20-36-52)54-42-44-56-64(72(49-29-13-5-14-30-49)50-31-15-6-16-32-50)46-63(55-43-41-53(57)65(54)66(55)56)71(47-25-9-3-10-26-47)48-27-11-4-12-28-48/h3-46H,1-2H3/q+2 |
| InChIKey | SGBODBDKMDNUQW-UHFFFAOYSA-N |
| XLogP | 16.39 |
| TPSA | 24.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 951.19 |
| LogP ≤ 5 | 16.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|