C34H43N2+ — CID 140940245
4-methyl-1-[4-phenyl-2,6-di(propan-2-yl)phenyl]-3-propan-2-yl-2-(2-propan-2-ylphenyl)imidazol-1-ium (PubChem CID 140940245) has the molecular formula C34H43N2+ and a molecular weight of 479.73 g/mol. Its IUPAC name is 4-methyl-1-[4-phenyl-2,6-di(propan-2-yl)phenyl]-3-propan-2-yl-2-(2-propan-2-ylphenyl)imidazol-1-ium.
| Compound Name | 4-methyl-1-[4-phenyl-2,6-di(propan-2-yl)phenyl]-3-propan-2-yl-2-(2-propan-2-ylphenyl)imidazol-1-ium |
|---|---|
| PubChem CID | 140940245 |
| Molecular Formula | C34H43N2+ |
| Molecular Weight | 479.73 g/mol |
| Exact Mass | 479.34 |
| IUPAC Name | 4-methyl-1-[4-phenyl-2,6-di(propan-2-yl)phenyl]-3-propan-2-yl-2-(2-propan-2-ylphenyl)imidazol-1-ium |
| SMILES | Cc1c[n+](-c2c(C(C)C)cc(-c3ccccc3)cc2C(C)C)c(-c2ccccc2C(C)C)n1C(C)C |
| InChI | InChI=1S/C34H43N2/c1-22(2)29-17-13-14-18-30(29)34-35(21-26(9)36(34)25(7)8)33-31(23(3)4)19-28(20-32(33)24(5)6)27-15-11-10-12-16-27/h10-25H,1-9H3/q+1 |
| InChIKey | XYADEQYXNDQTDD-UHFFFAOYSA-N |
| XLogP | 9.36 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.73 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|