C33H32N2O — CID 171438742
2-[4-phenyl-1-[4-phenyl-2,6-di(propan-2-yl)phenyl]imidazol-2-yl]phenol (PubChem CID 171438742) has the molecular formula C33H32N2O and a molecular weight of 472.63 g/mol. Its IUPAC name is 2-[4-phenyl-1-[4-phenyl-2,6-di(propan-2-yl)phenyl]imidazol-2-yl]phenol.
| Compound Name | 2-[4-phenyl-1-[4-phenyl-2,6-di(propan-2-yl)phenyl]imidazol-2-yl]phenol |
|---|---|
| PubChem CID | 171438742 |
| Molecular Formula | C33H32N2O |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | 2-[4-phenyl-1-[4-phenyl-2,6-di(propan-2-yl)phenyl]imidazol-2-yl]phenol |
| SMILES | CC(C)c1cc(-c2ccccc2)cc(C(C)C)c1-n1cc(-c2ccccc2)nc1-c1ccccc1O |
| InChI | InChI=1S/C33H32N2O/c1-22(2)28-19-26(24-13-7-5-8-14-24)20-29(23(3)4)32(28)35-21-30(25-15-9-6-10-16-25)34-33(35)27-17-11-12-18-31(27)36/h5-23,36H,1-4H3 |
| InChIKey | BCRGWYCYDSZTDF-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |