C23H34 — CID 173282541
5-methyl-1,2,3,4-tetra(propan-2-yl)naphthalene (PubChem CID 173282541) has the molecular formula C23H34 and a molecular weight of 310.52 g/mol. Its IUPAC name is 5-methyl-1,2,3,4-tetra(propan-2-yl)naphthalene.
| Compound Name | 5-methyl-1,2,3,4-tetra(propan-2-yl)naphthalene |
|---|---|
| PubChem CID | 173282541 |
| Molecular Formula | C23H34 |
| Molecular Weight | 310.52 g/mol |
| Exact Mass | 310.27 |
| IUPAC Name | 5-methyl-1,2,3,4-tetra(propan-2-yl)naphthalene |
| SMILES | Cc1cccc2c(C(C)C)c(C(C)C)c(C(C)C)c(C(C)C)c12 |
| InChI | InChI=1S/C23H34/c1-13(2)19-18-12-10-11-17(9)23(18)22(16(7)8)21(15(5)6)20(19)14(3)4/h10-16H,1-9H3 |
| InChIKey | CEGSEZWYMPWDQV-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.52 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |