C31H34O6 — CID 174280624
2,2-dimethylpropane-1,3-diol;phthalic acid;1,2,3,4-tetrahydrochrysene (PubChem CID 174280624) has the molecular formula C31H34O6 and a molecular weight of 502.61 g/mol. Its IUPAC name is 2,2-dimethylpropane-1,3-diol;phthalic acid;1,2,3,4-tetrahydrochrysene.
| Compound Name | 2,2-dimethylpropane-1,3-diol;phthalic acid;1,2,3,4-tetrahydrochrysene |
|---|---|
| PubChem CID | 174280624 |
| Molecular Formula | C31H34O6 |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 502.24 |
| IUPAC Name | 2,2-dimethylpropane-1,3-diol;phthalic acid;1,2,3,4-tetrahydrochrysene |
| SMILES | CC(C)(CO)CO.O=C(O)c1ccccc1C(=O)O.c1ccc2c(c1)ccc1c3c(ccc12)CCCC3 |
| InChI | InChI=1S/C18H16.C8H6O4.C5H12O2/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18;9-7(10)5-3-1-2-4-6(5)8(11)12;1-5(2,3-6)4-7/h1,3,5,7,9-12H,2,4,6,8H2;1-4H,(H,9,10)(H,11,12);6-7H,3-4H2,1-2H3 |
| InChIKey | IOMZWYMLLYPLBC-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|