C25H23NO2 — CID 174920657
2-hydroxybenzamide;1,2,3,4-tetrahydrochrysene (PubChem CID 174920657) has the molecular formula C25H23NO2 and a molecular weight of 369.46 g/mol. Its IUPAC name is 2-hydroxybenzamide;1,2,3,4-tetrahydrochrysene.
| Compound Name | 2-hydroxybenzamide;1,2,3,4-tetrahydrochrysene |
|---|---|
| PubChem CID | 174920657 |
| Molecular Formula | C25H23NO2 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 2-hydroxybenzamide;1,2,3,4-tetrahydrochrysene |
| SMILES | NC(=O)c1ccccc1O.c1ccc2c(c1)ccc1c3c(ccc12)CCCC3 |
| InChI | InChI=1S/C18H16.C7H7NO2/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18;8-7(10)5-3-1-2-4-6(5)9/h1,3,5,7,9-12H,2,4,6,8H2;1-4,9H,(H2,8,10) |
| InChIKey | PHIRLOHUTGOVME-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|