C27H24N2O — CID 174702682
1H-indole-3-carboxamide;1,2,3,4-tetrahydrochrysene (PubChem CID 174702682) has the molecular formula C27H24N2O and a molecular weight of 392.50 g/mol. Its IUPAC name is 1H-indole-3-carboxamide;1,2,3,4-tetrahydrochrysene.
| Compound Name | 1H-indole-3-carboxamide;1,2,3,4-tetrahydrochrysene |
|---|---|
| PubChem CID | 174702682 |
| Molecular Formula | C27H24N2O |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | 1H-indole-3-carboxamide;1,2,3,4-tetrahydrochrysene |
| SMILES | NC(=O)c1c[nH]c2ccccc12.c1ccc2c(c1)ccc1c3c(ccc12)CCCC3 |
| InChI | InChI=1S/C18H16.C9H8N2O/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18;10-9(12)7-5-11-8-4-2-1-3-6(7)8/h1,3,5,7,9-12H,2,4,6,8H2;1-5,11H,(H2,10,12) |
| InChIKey | VUQPQGCPJCMSFR-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|