C36H38N2O — CID 174864031
1-azabicyclo[2.2.2]octane;naphthalene-1-carboxamide;1,2,3,4-tetrahydrochrysene (PubChem CID 174864031) has the molecular formula C36H38N2O and a molecular weight of 514.71 g/mol. Its IUPAC name is 1-azabicyclo[2.2.2]octane;naphthalene-1-carboxamide;1,2,3,4-tetrahydrochrysene.
| Compound Name | 1-azabicyclo[2.2.2]octane;naphthalene-1-carboxamide;1,2,3,4-tetrahydrochrysene |
|---|---|
| PubChem CID | 174864031 |
| Molecular Formula | C36H38N2O |
| Molecular Weight | 514.71 g/mol |
| Exact Mass | 514.30 |
| IUPAC Name | 1-azabicyclo[2.2.2]octane;naphthalene-1-carboxamide;1,2,3,4-tetrahydrochrysene |
| SMILES | C1CN2CCC1CC2.NC(=O)c1cccc2ccccc12.c1ccc2c(c1)ccc1c3c(ccc12)CCCC3 |
| InChI | InChI=1S/C18H16.C11H9NO.C7H13N/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18;12-11(13)10-7-3-5-8-4-1-2-6-9(8)10;1-4-8-5-2-7(1)3-6-8/h1,3,5,7,9-12H,2,4,6,8H2;1-7H,(H2,12,13);7H,1-6H2 |
| InChIKey | UVWHGUUCZFWYPW-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.71 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|