C26H30O2 — CID 174613110
butyl 2-methylprop-2-enoate;1,2,3,4-tetrahydrochrysene (PubChem CID 174613110) has the molecular formula C26H30O2 and a molecular weight of 374.52 g/mol. Its IUPAC name is butyl 2-methylprop-2-enoate;1,2,3,4-tetrahydrochrysene.
| Compound Name | butyl 2-methylprop-2-enoate;1,2,3,4-tetrahydrochrysene |
|---|---|
| PubChem CID | 174613110 |
| Molecular Formula | C26H30O2 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | butyl 2-methylprop-2-enoate;1,2,3,4-tetrahydrochrysene |
| SMILES | C=C(C)C(=O)OCCCC.c1ccc2c(c1)ccc1c3c(ccc12)CCCC3 |
| InChI | InChI=1S/C18H16.C8H14O2/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18;1-4-5-6-10-8(9)7(2)3/h1,3,5,7,9-12H,2,4,6,8H2;2,4-6H2,1,3H3 |
| InChIKey | VLRIXISFNRDLBQ-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|