About 2,4-dichlorobenzenediazonium;trichloroiron;chloride
2,4-dichlorobenzenediazonium;trichloroiron;chloride (PubChem CID 139974846) has the molecular formula C6H3Cl6FeN2
and a molecular weight of 371.67 g/mol. Its IUPAC name is 2,4-dichlorobenzenediazonium;trichloroiron;chloride.
Molecular Properties
| Compound Name | 2,4-dichlorobenzenediazonium;trichloroiron;chloride |
| PubChem CID | 139974846 |
| Molecular Formula | C6H3Cl6FeN2 |
| Molecular Weight | 371.67 g/mol |
| Exact Mass | 368.78 |
| IUPAC Name | 2,4-dichlorobenzenediazonium;trichloroiron;chloride |
| SMILES | Cl[Fe](Cl)Cl.N#[N+]c1ccc(Cl)cc1Cl.[Cl-] |
| InChI | InChI=1S/C6H3Cl2N2.4ClH.Fe/c7-4-1-2-6(10-9)5(8)3-4;;;;;/h1-3H;4*1H;/q+1;;;;;+3/p-4 |
| InChIKey | ABNWGIOCZRYRGL-UHFFFAOYSA-J |
| XLogP | 2.55 |
| TPSA | 28.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.67 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dichlorobenzenediazonium;trichloroiron;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dichlorobenzenediazonium;trichloroiron;chloride?
The IUPAC name of 2,4-dichlorobenzenediazonium;trichloroiron;chloride (CID 139974846) is 2,4-dichlorobenzenediazonium;trichloroiron;chloride.
What is the SMILES notation for 2,4-dichlorobenzenediazonium;trichloroiron;chloride?
The canonical SMILES for 2,4-dichlorobenzenediazonium;trichloroiron;chloride is Cl[Fe](Cl)Cl.N#[N+]c1ccc(Cl)cc1Cl.[Cl-].
What is the InChIKey of 2,4-dichlorobenzenediazonium;trichloroiron;chloride?
The InChIKey is ABNWGIOCZRYRGL-UHFFFAOYSA-J. The full InChI is InChI=1S/C6H3Cl2N2.4ClH.Fe/c7-4-1-2-6(10-9)5(8)3-4;;;;;/h1-3H;4*1H;/q+1;;;;;+3/p-4.
What are the key properties of 2,4-dichlorobenzenediazonium;trichloroiron;chloride?
2,4-dichlorobenzenediazonium;trichloroiron;chloride has a molecular weight of 371.67 g/mol, XLogP of 2.55, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dichlorobenzenediazonium;trichloroiron;chloride is sourced from PubChem (CID 139974846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).