2,5-dichlorobenzenediazonium hexafluorophosphate

C6H3Cl2F6N2P — CID 22912688

IUPAC2,5-dichlorobenzenediazonium hexafluorophosphate
SMILESF[P-](F)(F)(F)(F)F.N#[N+]c1cc(Cl)ccc1Cl
InChIInChI=1S/C6H3Cl2N2.F6P/c7-4-1-2-5(8)6(3-4)10-9;1-7(2,3,4,5)6/h1-3H;/q+1;-1
InChIKeyPYYMDZODQUECLM-UHFFFAOYSA-N
MW318.97 g/mol
LogP6.86
Rot. Bonds

About 2,5-dichlorobenzenediazonium hexafluorophosphate

2,5-dichlorobenzenediazonium hexafluorophosphate (PubChem CID 22912688) has the molecular formula C6H3Cl2F6N2P and a molecular weight of 318.97 g/mol. Its IUPAC name is 2,5-dichlorobenzenediazonium hexafluorophosphate.

Molecular Properties

Compound Name2,5-dichlorobenzenediazonium hexafluorophosphate
PubChem CID22912688
Molecular FormulaC6H3Cl2F6N2P
Molecular Weight318.97 g/mol
Exact Mass317.93
IUPAC Name2,5-dichlorobenzenediazonium hexafluorophosphate
SMILESF[P-](F)(F)(F)(F)F.N#[N+]c1cc(Cl)ccc1Cl
InChIInChI=1S/C6H3Cl2N2.F6P/c7-4-1-2-5(8)6(3-4)10-9;1-7(2,3,4,5)6/h1-3H;/q+1;-1
InChIKeyPYYMDZODQUECLM-UHFFFAOYSA-N
XLogP6.86
TPSA28.15 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms17
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500318.97
LogP ≤ 56.86
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze 2,5-dichlorobenzenediazonium hexafluorophosphate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,5-dichlorobenzenediazonium hexafluorophosphate?
The IUPAC name of 2,5-dichlorobenzenediazonium hexafluorophosphate (CID 22912688) is 2,5-dichlorobenzenediazonium hexafluorophosphate.
What is the SMILES notation for 2,5-dichlorobenzenediazonium hexafluorophosphate?
The canonical SMILES for 2,5-dichlorobenzenediazonium hexafluorophosphate is F[P-](F)(F)(F)(F)F.N#[N+]c1cc(Cl)ccc1Cl.
What is the InChIKey of 2,5-dichlorobenzenediazonium hexafluorophosphate?
The InChIKey is PYYMDZODQUECLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3Cl2N2.F6P/c7-4-1-2-5(8)6(3-4)10-9;1-7(2,3,4,5)6/h1-3H;/q+1;-1.
What are the key properties of 2,5-dichlorobenzenediazonium hexafluorophosphate?
2,5-dichlorobenzenediazonium hexafluorophosphate has a molecular weight of 318.97 g/mol, XLogP of 6.86, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dichlorobenzenediazonium hexafluorophosphate is sourced from PubChem (CID 22912688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).