C6H7Cl2N3O3 — CID 138619614
(2,4-dichlorophenyl)hydrazine;nitric acid (PubChem CID 138619614) has the molecular formula C6H7Cl2N3O3 and a molecular weight of 240.05 g/mol. Its IUPAC name is (2,4-dichlorophenyl)hydrazine;nitric acid.
| Compound Name | (2,4-dichlorophenyl)hydrazine;nitric acid |
|---|---|
| PubChem CID | 138619614 |
| Molecular Formula | C6H7Cl2N3O3 |
| Molecular Weight | 240.05 g/mol |
| Exact Mass | 238.99 |
| IUPAC Name | (2,4-dichlorophenyl)hydrazine;nitric acid |
| SMILES | NNc1ccc(Cl)cc1Cl.O=[N+]([O-])O |
| InChI | InChI=1S/C6H6Cl2N2.HNO3/c7-4-1-2-6(10-9)5(8)3-4;2-1(3)4/h1-3,10H,9H2;(H,2,3,4) |
| InChIKey | GUCWAZMEMVSXCO-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 101.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.05 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|