(2,4-dichlorophenyl)hydrazine;nitric acid

C6H7Cl2N3O3 — CID 138619614

IUPAC(2,4-dichlorophenyl)hydrazine;nitric acid
SMILESNNc1ccc(Cl)cc1Cl.O=[N+]([O-])O
InChIInChI=1S/C6H6Cl2N2.HNO3/c7-4-1-2-6(10-9)5(8)3-4;2-1(3)4/h1-3,10H,9H2;(H,2,3,4)
InChIKeyGUCWAZMEMVSXCO-UHFFFAOYSA-N
MW240.05 g/mol
LogP1.93
Rot. Bonds1

About (2,4-dichlorophenyl)hydrazine;nitric acid

(2,4-dichlorophenyl)hydrazine;nitric acid (PubChem CID 138619614) has the molecular formula C6H7Cl2N3O3 and a molecular weight of 240.05 g/mol. Its IUPAC name is (2,4-dichlorophenyl)hydrazine;nitric acid.

Molecular Properties

Compound Name(2,4-dichlorophenyl)hydrazine;nitric acid
PubChem CID138619614
Molecular FormulaC6H7Cl2N3O3
Molecular Weight240.05 g/mol
Exact Mass238.99
IUPAC Name(2,4-dichlorophenyl)hydrazine;nitric acid
SMILESNNc1ccc(Cl)cc1Cl.O=[N+]([O-])O
InChIInChI=1S/C6H6Cl2N2.HNO3/c7-4-1-2-6(10-9)5(8)3-4;2-1(3)4/h1-3,10H,9H2;(H,2,3,4)
InChIKeyGUCWAZMEMVSXCO-UHFFFAOYSA-N
XLogP1.93
TPSA101.42 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500240.05
LogP ≤ 51.93
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze (2,4-dichlorophenyl)hydrazine;nitric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,4-dichlorophenyl)hydrazine;nitric acid?
The IUPAC name of (2,4-dichlorophenyl)hydrazine;nitric acid (CID 138619614) is (2,4-dichlorophenyl)hydrazine;nitric acid.
What is the SMILES notation for (2,4-dichlorophenyl)hydrazine;nitric acid?
The canonical SMILES for (2,4-dichlorophenyl)hydrazine;nitric acid is NNc1ccc(Cl)cc1Cl.O=[N+]([O-])O.
What is the InChIKey of (2,4-dichlorophenyl)hydrazine;nitric acid?
The InChIKey is GUCWAZMEMVSXCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6Cl2N2.HNO3/c7-4-1-2-6(10-9)5(8)3-4;2-1(3)4/h1-3,10H,9H2;(H,2,3,4).
What are the key properties of (2,4-dichlorophenyl)hydrazine;nitric acid?
(2,4-dichlorophenyl)hydrazine;nitric acid has a molecular weight of 240.05 g/mol, XLogP of 1.93, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dichlorophenyl)hydrazine;nitric acid is sourced from PubChem (CID 138619614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).