C6H5F4N3O3 — CID 138620267
nitric acid;(2,3,4,5-tetrafluorophenyl)hydrazine (PubChem CID 138620267) has the molecular formula C6H5F4N3O3 and a molecular weight of 243.12 g/mol. Its IUPAC name is nitric acid;(2,3,4,5-tetrafluorophenyl)hydrazine.
| Compound Name | nitric acid;(2,3,4,5-tetrafluorophenyl)hydrazine |
|---|---|
| PubChem CID | 138620267 |
| Molecular Formula | C6H5F4N3O3 |
| Molecular Weight | 243.12 g/mol |
| Exact Mass | 243.03 |
| IUPAC Name | nitric acid;(2,3,4,5-tetrafluorophenyl)hydrazine |
| SMILES | NNc1cc(F)c(F)c(F)c1F.O=[N+]([O-])O |
| InChI | InChI=1S/C6H4F4N2.HNO3/c7-2-1-3(12-11)5(9)6(10)4(2)8;2-1(3)4/h1,12H,11H2;(H,2,3,4) |
| InChIKey | SCWZBVVMMWWNLF-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 101.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.12 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|