(2-fluoro-4-methoxyphenyl)hydrazine;nitric acid

C7H10FN3O4 — CID 138619436

IUPAC(2-fluoro-4-methoxyphenyl)hydrazine;nitric acid
SMILESCOc1ccc(NN)c(F)c1.O=[N+]([O-])O
InChIInChI=1S/C7H9FN2O.HNO3/c1-11-5-2-3-7(10-9)6(8)4-5;2-1(3)4/h2-4,10H,9H2,1H3;(H,2,3,4)
InChIKeyHYGSGWFPNKNHKV-UHFFFAOYSA-N
MW219.17 g/mol
LogP0.77
Rot. Bonds2

About (2-fluoro-4-methoxyphenyl)hydrazine;nitric acid

(2-fluoro-4-methoxyphenyl)hydrazine;nitric acid (PubChem CID 138619436) has the molecular formula C7H10FN3O4 and a molecular weight of 219.17 g/mol. Its IUPAC name is (2-fluoro-4-methoxyphenyl)hydrazine;nitric acid.

Molecular Properties

Compound Name(2-fluoro-4-methoxyphenyl)hydrazine;nitric acid
PubChem CID138619436
Molecular FormulaC7H10FN3O4
Molecular Weight219.17 g/mol
Exact Mass219.07
IUPAC Name(2-fluoro-4-methoxyphenyl)hydrazine;nitric acid
SMILESCOc1ccc(NN)c(F)c1.O=[N+]([O-])O
InChIInChI=1S/C7H9FN2O.HNO3/c1-11-5-2-3-7(10-9)6(8)4-5;2-1(3)4/h2-4,10H,9H2,1H3;(H,2,3,4)
InChIKeyHYGSGWFPNKNHKV-UHFFFAOYSA-N
XLogP0.77
TPSA110.65 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500219.17
LogP ≤ 50.77
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze (2-fluoro-4-methoxyphenyl)hydrazine;nitric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2-fluoro-4-methoxyphenyl)hydrazine;nitric acid?
The IUPAC name of (2-fluoro-4-methoxyphenyl)hydrazine;nitric acid (CID 138619436) is (2-fluoro-4-methoxyphenyl)hydrazine;nitric acid.
What is the SMILES notation for (2-fluoro-4-methoxyphenyl)hydrazine;nitric acid?
The canonical SMILES for (2-fluoro-4-methoxyphenyl)hydrazine;nitric acid is COc1ccc(NN)c(F)c1.O=[N+]([O-])O.
What is the InChIKey of (2-fluoro-4-methoxyphenyl)hydrazine;nitric acid?
The InChIKey is HYGSGWFPNKNHKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9FN2O.HNO3/c1-11-5-2-3-7(10-9)6(8)4-5;2-1(3)4/h2-4,10H,9H2,1H3;(H,2,3,4).
What are the key properties of (2-fluoro-4-methoxyphenyl)hydrazine;nitric acid?
(2-fluoro-4-methoxyphenyl)hydrazine;nitric acid has a molecular weight of 219.17 g/mol, XLogP of 0.77, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-fluoro-4-methoxyphenyl)hydrazine;nitric acid is sourced from PubChem (CID 138619436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).