C11H9ClO3 — CID 169485391
2-[2-chloro-4-(3-hydroxyprop-1-ynyl)phenyl]acetic acid (PubChem CID 169485391) has the molecular formula C11H9ClO3 and a molecular weight of 224.64 g/mol. Its IUPAC name is 2-[2-chloro-4-(3-hydroxyprop-1-ynyl)phenyl]acetic acid.
| Compound Name | 2-[2-chloro-4-(3-hydroxyprop-1-ynyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 169485391 |
| Molecular Formula | C11H9ClO3 |
| Molecular Weight | 224.64 g/mol |
| Exact Mass | 224.02 |
| IUPAC Name | 2-[2-chloro-4-(3-hydroxyprop-1-ynyl)phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(C#CCO)cc1Cl |
| InChI | InChI=1S/C11H9ClO3/c12-10-6-8(2-1-5-13)3-4-9(10)7-11(14)15/h3-4,6,13H,5,7H2,(H,14,15) |
| InChIKey | PCOVJYNPCXSSBP-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.64 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|