C14H19N — CID 115872858
N,2,4-trimethyl-N-pent-4-ynylaniline (PubChem CID 115872858) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is N,2,4-trimethyl-N-pent-4-ynylaniline.
| Compound Name | N,2,4-trimethyl-N-pent-4-ynylaniline |
|---|---|
| PubChem CID | 115872858 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | N,2,4-trimethyl-N-pent-4-ynylaniline |
| SMILES | C#CCCCN(C)c1ccc(C)cc1C |
| InChI | InChI=1S/C14H19N/c1-5-6-7-10-15(4)14-9-8-12(2)11-13(14)3/h1,8-9,11H,6-7,10H2,2-4H3 |
| InChIKey | FGHRZVYHEUORIE-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|