C16H27NO2 — CID 55248017
N-(3,3-diethoxypropyl)-N,2,4-trimethylaniline (PubChem CID 55248017) has the molecular formula C16H27NO2 and a molecular weight of 265.40 g/mol. Its IUPAC name is N-(3,3-diethoxypropyl)-N,2,4-trimethylaniline.
| Compound Name | N-(3,3-diethoxypropyl)-N,2,4-trimethylaniline |
|---|---|
| PubChem CID | 55248017 |
| Molecular Formula | C16H27NO2 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | N-(3,3-diethoxypropyl)-N,2,4-trimethylaniline |
| SMILES | CCOC(CCN(C)c1ccc(C)cc1C)OCC |
| InChI | InChI=1S/C16H27NO2/c1-6-18-16(19-7-2)10-11-17(5)15-9-8-13(3)12-14(15)4/h8-9,12,16H,6-7,10-11H2,1-5H3 |
| InChIKey | BUYDUNYIZJOOET-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|