C16H25N3 — CID 106803450
2-amino-2-ethyl-5-(N,2,4-trimethylanilino)pentanenitrile (PubChem CID 106803450) has the molecular formula C16H25N3 and a molecular weight of 259.40 g/mol. Its IUPAC name is 2-amino-2-ethyl-5-(N,2,4-trimethylanilino)pentanenitrile.
| Compound Name | 2-amino-2-ethyl-5-(N,2,4-trimethylanilino)pentanenitrile |
|---|---|
| PubChem CID | 106803450 |
| Molecular Formula | C16H25N3 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.20 |
| IUPAC Name | 2-amino-2-ethyl-5-(N,2,4-trimethylanilino)pentanenitrile |
| SMILES | CCC(N)(C#N)CCCN(C)c1ccc(C)cc1C |
| InChI | InChI=1S/C16H25N3/c1-5-16(18,12-17)9-6-10-19(4)15-8-7-13(2)11-14(15)3/h7-8,11H,5-6,9-10,18H2,1-4H3 |
| InChIKey | LSWTWNHBVFDWTM-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 53.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |