C16H28N2O — CID 106808963
2-amino-2-ethyl-5-(N,2,4-trimethylanilino)pentan-1-ol (PubChem CID 106808963) has the molecular formula C16H28N2O and a molecular weight of 264.41 g/mol. Its IUPAC name is 2-amino-2-ethyl-5-(N,2,4-trimethylanilino)pentan-1-ol.
| Compound Name | 2-amino-2-ethyl-5-(N,2,4-trimethylanilino)pentan-1-ol |
|---|---|
| PubChem CID | 106808963 |
| Molecular Formula | C16H28N2O |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.22 |
| IUPAC Name | 2-amino-2-ethyl-5-(N,2,4-trimethylanilino)pentan-1-ol |
| SMILES | CCC(N)(CO)CCCN(C)c1ccc(C)cc1C |
| InChI | InChI=1S/C16H28N2O/c1-5-16(17,12-19)9-6-10-18(4)15-8-7-13(2)11-14(15)3/h7-8,11,19H,5-6,9-10,12,17H2,1-4H3 |
| InChIKey | LDPZSLGPJAEEDS-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |