C13H21NO — CID 115133229
2-methyl-2-(N,2,4-trimethylanilino)propan-1-ol (PubChem CID 115133229) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is 2-methyl-2-(N,2,4-trimethylanilino)propan-1-ol.
| Compound Name | 2-methyl-2-(N,2,4-trimethylanilino)propan-1-ol |
|---|---|
| PubChem CID | 115133229 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | 2-methyl-2-(N,2,4-trimethylanilino)propan-1-ol |
| SMILES | Cc1ccc(N(C)C(C)(C)CO)c(C)c1 |
| InChI | InChI=1S/C13H21NO/c1-10-6-7-12(11(2)8-10)14(5)13(3,4)9-15/h6-8,15H,9H2,1-5H3 |
| InChIKey | CISIVHDSDABPNG-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |