C12H18BrNO — CID 112561545
1-bromo-3-(N,2,4-trimethylanilino)propan-2-ol (PubChem CID 112561545) has the molecular formula C12H18BrNO and a molecular weight of 272.19 g/mol. Its IUPAC name is 1-bromo-3-(N,2,4-trimethylanilino)propan-2-ol.
| Compound Name | 1-bromo-3-(N,2,4-trimethylanilino)propan-2-ol |
|---|---|
| PubChem CID | 112561545 |
| Molecular Formula | C12H18BrNO |
| Molecular Weight | 272.19 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 1-bromo-3-(N,2,4-trimethylanilino)propan-2-ol |
| SMILES | Cc1ccc(N(C)CC(O)CBr)c(C)c1 |
| InChI | InChI=1S/C12H18BrNO/c1-9-4-5-12(10(2)6-9)14(3)8-11(15)7-13/h4-6,11,15H,7-8H2,1-3H3 |
| InChIKey | GRHXVABYMCVSOY-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.19 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|