C18H28BrN — CID 65010427
N-[[1-(bromomethyl)cycloheptyl]methyl]-N,2,4-trimethylaniline (PubChem CID 65010427) has the molecular formula C18H28BrN and a molecular weight of 338.33 g/mol. Its IUPAC name is N-[[1-(bromomethyl)cycloheptyl]methyl]-N,2,4-trimethylaniline.
| Compound Name | N-[[1-(bromomethyl)cycloheptyl]methyl]-N,2,4-trimethylaniline |
|---|---|
| PubChem CID | 65010427 |
| Molecular Formula | C18H28BrN |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | N-[[1-(bromomethyl)cycloheptyl]methyl]-N,2,4-trimethylaniline |
| SMILES | Cc1ccc(N(C)CC2(CBr)CCCCCC2)c(C)c1 |
| InChI | InChI=1S/C18H28BrN/c1-15-8-9-17(16(2)12-15)20(3)14-18(13-19)10-6-4-5-7-11-18/h8-9,12H,4-7,10-11,13-14H2,1-3H3 |
| InChIKey | HFSAECYBXLMMRC-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|