About 1-(bromomethyl)-1-[(2,4,6-trimethylphenoxy)methyl]cycloheptane
1-(bromomethyl)-1-[(2,4,6-trimethylphenoxy)methyl]cycloheptane (PubChem CID 65010061) has the molecular formula C18H27BrO
and a molecular weight of 339.32 g/mol. Its IUPAC name is 1-(bromomethyl)-1-[(2,4,6-trimethylphenoxy)methyl]cycloheptane.
Molecular Properties
| Compound Name | 1-(bromomethyl)-1-[(2,4,6-trimethylphenoxy)methyl]cycloheptane |
| PubChem CID | 65010061 |
| Molecular Formula | C18H27BrO |
| Molecular Weight | 339.32 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 1-(bromomethyl)-1-[(2,4,6-trimethylphenoxy)methyl]cycloheptane |
| SMILES | Cc1cc(C)c(OCC2(CBr)CCCCCC2)c(C)c1 |
| InChI | InChI=1S/C18H27BrO/c1-14-10-15(2)17(16(3)11-14)20-13-18(12-19)8-6-4-5-7-9-18/h10-11H,4-9,12-13H2,1-3H3 |
| InChIKey | DMNFDHOWBPTWTL-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 339.32 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(bromomethyl)-1-[(2,4,6-trimethylphenoxy)methyl]cycloheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(bromomethyl)-1-[(2,4,6-trimethylphenoxy)methyl]cycloheptane?
The IUPAC name of 1-(bromomethyl)-1-[(2,4,6-trimethylphenoxy)methyl]cycloheptane (CID 65010061) is 1-(bromomethyl)-1-[(2,4,6-trimethylphenoxy)methyl]cycloheptane.
What is the SMILES notation for 1-(bromomethyl)-1-[(2,4,6-trimethylphenoxy)methyl]cycloheptane?
The canonical SMILES for 1-(bromomethyl)-1-[(2,4,6-trimethylphenoxy)methyl]cycloheptane is Cc1cc(C)c(OCC2(CBr)CCCCCC2)c(C)c1.
What is the InChIKey of 1-(bromomethyl)-1-[(2,4,6-trimethylphenoxy)methyl]cycloheptane?
The InChIKey is DMNFDHOWBPTWTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27BrO/c1-14-10-15(2)17(16(3)11-14)20-13-18(12-19)8-6-4-5-7-9-18/h10-11H,4-9,12-13H2,1-3H3.
What are the key properties of 1-(bromomethyl)-1-[(2,4,6-trimethylphenoxy)methyl]cycloheptane?
1-(bromomethyl)-1-[(2,4,6-trimethylphenoxy)methyl]cycloheptane has a molecular weight of 339.32 g/mol, XLogP of 5.73, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(bromomethyl)-1-[(2,4,6-trimethylphenoxy)methyl]cycloheptane is sourced from PubChem (CID 65010061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).