C16H23Br — CID 66048678
4-[[1-(bromomethyl)cyclohexyl]methyl]-1,2-dimethylbenzene (PubChem CID 66048678) has the molecular formula C16H23Br and a molecular weight of 295.26 g/mol. Its IUPAC name is 4-[[1-(bromomethyl)cyclohexyl]methyl]-1,2-dimethylbenzene.
| Compound Name | 4-[[1-(bromomethyl)cyclohexyl]methyl]-1,2-dimethylbenzene |
|---|---|
| PubChem CID | 66048678 |
| Molecular Formula | C16H23Br |
| Molecular Weight | 295.26 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 4-[[1-(bromomethyl)cyclohexyl]methyl]-1,2-dimethylbenzene |
| SMILES | Cc1ccc(CC2(CBr)CCCCC2)cc1C |
| InChI | InChI=1S/C16H23Br/c1-13-6-7-15(10-14(13)2)11-16(12-17)8-4-3-5-9-16/h6-7,10H,3-5,8-9,11-12H2,1-2H3 |
| InChIKey | OCXFONHCRHVHQY-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.26 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|